C30H42FN5 — CID 154969676
(16E,20E)-5-fluoro-N,15,16,18,20-pentamethyl-2,11-dimethylidene-1,12,15,19-tetrazatricyclo[21.4.0.03,8]heptacosa-3(8),4,6,16,18,20-hexaen-22-imine (PubChem CID 154969676) has the molecular formula C30H42FN5 and a molecular weight of 491.70 g/mol. Its IUPAC name is (16E,20E)-5-fluoro-N,15,16,18,20-pentamethyl-2,11-dimethylidene-1,12,15,19-tetrazatricyclo[21.4.0.03,8]heptacosa-3(8),4,6,16,18,20-hexaen-22-imine.
| Compound Name | (16E,20E)-5-fluoro-N,15,16,18,20-pentamethyl-2,11-dimethylidene-1,12,15,19-tetrazatricyclo[21.4.0.03,8]heptacosa-3(8),4,6,16,18,20-hexaen-22-imine |
|---|---|
| PubChem CID | 154969676 |
| Molecular Formula | C30H42FN5 |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.34 |
| IUPAC Name | (16E,20E)-5-fluoro-N,15,16,18,20-pentamethyl-2,11-dimethylidene-1,12,15,19-tetrazatricyclo[21.4.0.03,8]heptacosa-3(8),4,6,16,18,20-hexaen-22-imine |
| SMILES | C=C1CCc2ccc(F)cc2C(=C)N2CCCCC2C(=N/C)/C=C(C)/N=C(C)\C=C(/C)N(C)CCN1 |
| InChI | InChI=1S/C30H42FN5/c1-21-11-12-26-13-14-27(31)20-28(26)25(5)36-16-9-8-10-30(36)29(32-6)19-23(3)34-22(2)18-24(4)35(7)17-15-33-21/h13-14,18-20,30,33H,1,5,8-12,15-17H2,2-4,6-7H3/b23-19+,24-18+,32-29+,34-22- |
| InChIKey | HMKCWUCIVLTSSH-ZZSWYUNJSA-N |
| XLogP | 5.97 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|