C21H37N3 — CID 154970113
(E)-2-N-[1-(azetidin-1-yl)-2,3-dimethylbut-2-enylidene]-4-N,5-dimethyldec-2-ene-2,4-diimine (PubChem CID 154970113) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is (E)-2-N-[1-(azetidin-1-yl)-2,3-dimethylbut-2-enylidene]-4-N,5-dimethyldec-2-ene-2,4-diimine.
| Compound Name | (E)-2-N-[1-(azetidin-1-yl)-2,3-dimethylbut-2-enylidene]-4-N,5-dimethyldec-2-ene-2,4-diimine |
|---|---|
| PubChem CID | 154970113 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | (E)-2-N-[1-(azetidin-1-yl)-2,3-dimethylbut-2-enylidene]-4-N,5-dimethyldec-2-ene-2,4-diimine |
| SMILES | CCCCCC(C)C(/C=C(C)/N=C(/C(C)=C(C)C)N1CCC1)=N\C |
| InChI | InChI=1S/C21H37N3/c1-8-9-10-12-17(4)20(22-7)15-18(5)23-21(19(6)16(2)3)24-13-11-14-24/h15,17H,8-14H2,1-7H3/b18-15+,22-20-,23-21- |
| InChIKey | BLJHHYUFDOHSJX-FXDXMMGBSA-N |
| XLogP | 5.64 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|