C23H25NO3 — CID 15497035
7,9-ditert-butyl-10a-hydroxyindeno[2,1-b][1,4]benzoxazin-11-one (PubChem CID 15497035) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 7,9-ditert-butyl-10a-hydroxyindeno[2,1-b][1,4]benzoxazin-11-one.
| Compound Name | 7,9-ditert-butyl-10a-hydroxyindeno[2,1-b][1,4]benzoxazin-11-one |
|---|---|
| PubChem CID | 15497035 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 7,9-ditert-butyl-10a-hydroxyindeno[2,1-b][1,4]benzoxazin-11-one |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OC1(O)C(=O)c3ccccc3C1=N2 |
| InChI | InChI=1S/C23H25NO3/c1-21(2,3)13-11-16(22(4,5)6)18-17(12-13)24-19-14-9-7-8-10-15(14)20(25)23(19,26)27-18/h7-12,26H,1-6H3 |
| InChIKey | UIENZCJZSDJLFJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |