C32H36ClFN6O2 — CID 154970621
6-chloro-1-[(2Z,4E)-3,6-dimethyl-5-(methylideneamino)hepta-2,4-dien-4-yl]-4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-(2-fluorophenyl)pyrido[2,3-d]pyrimidin-2-one (PubChem CID 154970621) has the molecular formula C32H36ClFN6O2 and a molecular weight of 591.13 g/mol. Its IUPAC name is 6-chloro-1-[(2Z,4E)-3,6-dimethyl-5-(methylideneamino)hepta-2,4-dien-4-yl]-4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-(2-fluorophenyl)pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 6-chloro-1-[(2Z,4E)-3,6-dimethyl-5-(methylideneamino)hepta-2,4-dien-4-yl]-4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-(2-fluorophenyl)pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 154970621 |
| Molecular Formula | C32H36ClFN6O2 |
| Molecular Weight | 591.13 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | 6-chloro-1-[(2Z,4E)-3,6-dimethyl-5-(methylideneamino)hepta-2,4-dien-4-yl]-4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-(2-fluorophenyl)pyrido[2,3-d]pyrimidin-2-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(c2nc(=O)n(C(/C(C)=C\C)=C(/N=C)C(C)C)c3nc(-c4ccccc4F)c(Cl)cc23)C[C@H]1C |
| InChI | InChI=1S/C32H36ClFN6O2/c1-9-19(5)29(27(35-8)18(3)4)40-31-23(15-24(33)28(36-31)22-13-11-12-14-25(22)34)30(37-32(40)42)39-17-20(6)38(16-21(39)7)26(41)10-2/h9-15,18,20-21H,2,8,16-17H2,1,3-7H3/b19-9-,29-27+/t20-,21+/m1/s1 |
| InChIKey | PKBKTFGMFCITNT-ROCJTRMOSA-N |
| XLogP | 6.35 |
| TPSA | 83.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.13 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|