C19H32FNO — CID 154971019
2-fluoro-N-methyl-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]propanamide (PubChem CID 154971019) has the molecular formula C19H32FNO and a molecular weight of 309.47 g/mol. Its IUPAC name is 2-fluoro-N-methyl-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]propanamide.
| Compound Name | 2-fluoro-N-methyl-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]propanamide |
|---|---|
| PubChem CID | 154971019 |
| Molecular Formula | C19H32FNO |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 2-fluoro-N-methyl-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]propanamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN(C)C(=O)C(C)F |
| InChI | InChI=1S/C19H32FNO/c1-15(2)9-7-10-16(3)11-8-12-17(4)13-14-21(6)19(22)18(5)20/h9,11,13,18H,7-8,10,12,14H2,1-6H3/b16-11+,17-13+ |
| InChIKey | UCEFTTFHXGHRNB-IUBLYSDUSA-N |
| XLogP | 5.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|