C22H24F5N5O — CID 154971399
5-[1-(2,2-difluoroethyl)-5-[(1S,2S,7R)-4-morpholin-4-yl-7-tricyclo[3.2.0.02,7]heptanyl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 154971399) has the molecular formula C22H24F5N5O and a molecular weight of 469.46 g/mol. Its IUPAC name is 5-[1-(2,2-difluoroethyl)-5-[(1S,2S,7R)-4-morpholin-4-yl-7-tricyclo[3.2.0.02,7]heptanyl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-[1-(2,2-difluoroethyl)-5-[(1S,2S,7R)-4-morpholin-4-yl-7-tricyclo[3.2.0.02,7]heptanyl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 154971399 |
| Molecular Formula | C22H24F5N5O |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 5-[1-(2,2-difluoroethyl)-5-[(1S,2S,7R)-4-morpholin-4-yl-7-tricyclo[3.2.0.02,7]heptanyl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1ncc(-c2cc([C@]34CC5C(N6CCOCC6)C[C@H]3[C@@H]54)n(CC(F)F)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H24F5N5O/c23-18(24)10-32-17(7-15(30-32)11-5-14(22(25,26)27)20(28)29-9-11)21-8-12-16(6-13(21)19(12)21)31-1-3-33-4-2-31/h5,7,9,12-13,16,18-19H,1-4,6,8,10H2,(H2,28,29)/t12?,13-,16?,19+,21-/m0/s1 |
| InChIKey | OORZVVUOYSEZGW-ZSPYHTQGSA-N |
| XLogP | 3.42 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |