C8H9IN2 — CID 154971496
(4E,6S)-6-iodo-4-prop-2-enylidene-5,6-dihydro-1,3-diazepine (PubChem CID 154971496) has the molecular formula C8H9IN2 and a molecular weight of 260.08 g/mol. Its IUPAC name is (4E,6S)-6-iodo-4-prop-2-enylidene-5,6-dihydro-1,3-diazepine.
| Compound Name | (4E,6S)-6-iodo-4-prop-2-enylidene-5,6-dihydro-1,3-diazepine |
|---|---|
| PubChem CID | 154971496 |
| Molecular Formula | C8H9IN2 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | (4E,6S)-6-iodo-4-prop-2-enylidene-5,6-dihydro-1,3-diazepine |
| SMILES | C=C/C=C1\C[C@H](I)C=NC=N1 |
| InChI | InChI=1S/C8H9IN2/c1-2-3-8-4-7(9)5-10-6-11-8/h2-3,5-7H,1,4H2/b8-3+/t7-/m0/s1 |
| InChIKey | XWVUVSDDJNNSIV-TWGKFFBLSA-N |
| XLogP | 2.36 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|