About (E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine
(E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine (PubChem CID 154971548) has the molecular formula C16H32N2
and a molecular weight of 252.45 g/mol. Its IUPAC name is (E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine |
| PubChem CID | 154971548 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | (E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine |
| SMILES | [H]/N=C(\CC(C)C)C(C)/C=C(\C)CNCC(C)CC |
| InChI | InChI=1S/C16H32N2/c1-7-13(4)10-18-11-14(5)9-15(6)16(17)8-12(2)3/h9,12-13,15,17-18H,7-8,10-11H2,1-6H3/b14-9+,17-16+ |
| InChIKey | NMJDCQVWTGXJIJ-WNBKNDGGSA-N |
| XLogP | 4.27 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine?
The IUPAC name of (E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine (CID 154971548) is (E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine.
What is the SMILES notation for (E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine?
The canonical SMILES for (E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine is [H]/N=C(\CC(C)C)C(C)/C=C(\C)CNCC(C)CC.
What is the InChIKey of (E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine?
The InChIKey is NMJDCQVWTGXJIJ-WNBKNDGGSA-N. The full InChI is InChI=1S/C16H32N2/c1-7-13(4)10-18-11-14(5)9-15(6)16(17)8-12(2)3/h9,12-13,15,17-18H,7-8,10-11H2,1-6H3/b14-9+,17-16+.
What are the key properties of (E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine?
(E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine has a molecular weight of 252.45 g/mol, XLogP of 4.27, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-imino-2,4,7-trimethyl-N-(2-methylbutyl)oct-2-en-1-amine is sourced from PubChem (CID 154971548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).