C26H35N — CID 154972054
1,1,3,3-tetramethyl-N-(1,1,3,3-tetramethyl-2H-inden-5-yl)-2H-inden-5-amine (PubChem CID 154972054) has the molecular formula C26H35N and a molecular weight of 361.57 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-N-(1,1,3,3-tetramethyl-2H-inden-5-yl)-2H-inden-5-amine.
| Compound Name | 1,1,3,3-tetramethyl-N-(1,1,3,3-tetramethyl-2H-inden-5-yl)-2H-inden-5-amine |
|---|---|
| PubChem CID | 154972054 |
| Molecular Formula | C26H35N |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | 1,1,3,3-tetramethyl-N-(1,1,3,3-tetramethyl-2H-inden-5-yl)-2H-inden-5-amine |
| SMILES | CC1(C)CC(C)(C)c2cc(Nc3ccc4c(c3)C(C)(C)CC4(C)C)ccc21 |
| InChI | InChI=1S/C26H35N/c1-23(2)15-25(5,6)21-13-17(9-11-19(21)23)27-18-10-12-20-22(14-18)26(7,8)16-24(20,3)4/h9-14,27H,15-16H2,1-8H3 |
| InChIKey | NHPMDINHISGACL-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |