C57H47N — CID 154972869
N,N-bis[3-(9,9-dimethylfluoren-2-yl)phenyl]-9,9-dimethylfluoren-3-amine (PubChem CID 154972869) has the molecular formula C57H47N and a molecular weight of 746.01 g/mol. Its IUPAC name is N,N-bis[3-(9,9-dimethylfluoren-2-yl)phenyl]-9,9-dimethylfluoren-3-amine.
| Compound Name | N,N-bis[3-(9,9-dimethylfluoren-2-yl)phenyl]-9,9-dimethylfluoren-3-amine |
|---|---|
| PubChem CID | 154972869 |
| Molecular Formula | C57H47N |
| Molecular Weight | 746.01 g/mol |
| Exact Mass | 745.37 |
| IUPAC Name | N,N-bis[3-(9,9-dimethylfluoren-2-yl)phenyl]-9,9-dimethylfluoren-3-amine |
| SMILES | CC1(C)c2ccccc2-c2cc(N(c3cccc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c3)c3cccc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c3)ccc21 |
| InChI | InChI=1S/C57H47N/c1-55(2)51-24-12-9-21-45(51)48-35-42(27-30-52(48)55)58(40-17-13-15-36(31-40)38-25-28-46-43-19-7-10-22-49(43)56(3,4)53(46)33-38)41-18-14-16-37(32-41)39-26-29-47-44-20-8-11-23-50(44)57(5,6)54(47)34-39/h7-35H,1-6H3 |
| InChIKey | VEZMIXQLAWHPFL-UHFFFAOYSA-N |
| XLogP | 15.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.01 |
| LogP ≤ 5 | 15.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |