C5H10N2OS — CID 15497301
2,2-dimethyl-1,3,4-thiadiazinan-5-one (PubChem CID 15497301) has the molecular formula C5H10N2OS and a molecular weight of 146.21 g/mol. Its IUPAC name is 2,2-dimethyl-1,3,4-thiadiazinan-5-one.
| Compound Name | 2,2-dimethyl-1,3,4-thiadiazinan-5-one |
|---|---|
| PubChem CID | 15497301 |
| Molecular Formula | C5H10N2OS |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 2,2-dimethyl-1,3,4-thiadiazinan-5-one |
| SMILES | CC1(C)NNC(=O)CS1 |
| InChI | InChI=1S/C5H10N2OS/c1-5(2)7-6-4(8)3-9-5/h7H,3H2,1-2H3,(H,6,8) |
| InChIKey | INRVEKDZSFHRND-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |