C8H14F6N2O5S2 — CID 154973315
1,1,1-trifluoro-N-[3-(hydroxyamino)hexan-3-yl]-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 154973315) has the molecular formula C8H14F6N2O5S2 and a molecular weight of 396.33 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[3-(hydroxyamino)hexan-3-yl]-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[3-(hydroxyamino)hexan-3-yl]-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 154973315 |
| Molecular Formula | C8H14F6N2O5S2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 1,1,1-trifluoro-N-[3-(hydroxyamino)hexan-3-yl]-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCCC(CC)(NO)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H14F6N2O5S2/c1-3-5-6(4-2,15-17)16(22(18,19)7(9,10)11)23(20,21)8(12,13)14/h15,17H,3-5H2,1-2H3 |
| InChIKey | RQRBANCSGUZKKS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|