C23H33N5O3 — CID 154973344
4-hydroxy-N-[7-methoxy-4-[(2Z,4Z)-7-(methylamino)hepta-2,4-dien-4-yl]-1H-benzimidazol-2-yl]-4-methylpiperidine-1-carboxamide (PubChem CID 154973344) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-hydroxy-N-[7-methoxy-4-[(2Z,4Z)-7-(methylamino)hepta-2,4-dien-4-yl]-1H-benzimidazol-2-yl]-4-methylpiperidine-1-carboxamide.
| Compound Name | 4-hydroxy-N-[7-methoxy-4-[(2Z,4Z)-7-(methylamino)hepta-2,4-dien-4-yl]-1H-benzimidazol-2-yl]-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 154973344 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 4-hydroxy-N-[7-methoxy-4-[(2Z,4Z)-7-(methylamino)hepta-2,4-dien-4-yl]-1H-benzimidazol-2-yl]-4-methylpiperidine-1-carboxamide |
| SMILES | C/C=C\C(=C\CCNC)c1ccc(OC)c2[nH]c(NC(=O)N3CCC(C)(O)CC3)nc12 |
| InChI | InChI=1S/C23H33N5O3/c1-5-7-16(8-6-13-24-3)17-9-10-18(31-4)20-19(17)25-21(26-20)27-22(29)28-14-11-23(2,30)12-15-28/h5,7-10,24,30H,6,11-15H2,1-4H3,(H2,25,26,27,29)/b7-5-,16-8- |
| InChIKey | QLRLGBBOQZWHIZ-GOIYAPCLSA-N |
| XLogP | 3.52 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|