About 3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine
3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine (PubChem CID 154973454) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is 3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine |
| PubChem CID | 154973454 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine |
| SMILES | CCC1=CN=CC(CC(C)(C)CC)C1C |
| InChI | InChI=1S/C14H25N/c1-6-12-9-15-10-13(11(12)3)8-14(4,5)7-2/h9-11,13H,6-8H2,1-5H3 |
| InChIKey | YEYWJLHUSSFZTI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine?
The IUPAC name of 3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine (CID 154973454) is 3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine.
What is the SMILES notation for 3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine?
The canonical SMILES for 3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine is CCC1=CN=CC(CC(C)(C)CC)C1C.
What is the InChIKey of 3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine?
The InChIKey is YEYWJLHUSSFZTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-6-12-9-15-10-13(11(12)3)8-14(4,5)7-2/h9-11,13H,6-8H2,1-5H3.
What are the key properties of 3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine?
3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine has a molecular weight of 207.36 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethylbutyl)-5-ethyl-4-methyl-3,4-dihydropyridine is sourced from PubChem (CID 154973454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).