C21H38N2 — CID 154973455
(6Z,8Z)-N-(7-imino-2-methylhept-2-en-4-yl)-N,3-dimethylundeca-6,8-dien-2-amine (PubChem CID 154973455) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is (6Z,8Z)-N-(7-imino-2-methylhept-2-en-4-yl)-N,3-dimethylundeca-6,8-dien-2-amine.
| Compound Name | (6Z,8Z)-N-(7-imino-2-methylhept-2-en-4-yl)-N,3-dimethylundeca-6,8-dien-2-amine |
|---|---|
| PubChem CID | 154973455 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | (6Z,8Z)-N-(7-imino-2-methylhept-2-en-4-yl)-N,3-dimethylundeca-6,8-dien-2-amine |
| SMILES | [H]/N=C/CCC(C=C(C)C)N(C)C(C)C(C)CC/C=C\C=C/CC |
| InChI | InChI=1S/C21H38N2/c1-7-8-9-10-11-12-14-19(4)20(5)23(6)21(15-13-16-22)17-18(2)3/h8-11,16-17,19-22H,7,12-15H2,1-6H3/b9-8-,11-10-,22-16+ |
| InChIKey | LBFZMLOELADVGB-IOYQIHNBSA-N |
| XLogP | 6.01 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|