About 1-(3,3-dimethylbut-1-en-2-yl)-3,3-difluoroazetidine
1-(3,3-dimethylbut-1-en-2-yl)-3,3-difluoroazetidine (PubChem CID 154973616) has the molecular formula C9H15F2N
and a molecular weight of 175.22 g/mol. Its IUPAC name is 1-(3,3-dimethylbut-1-en-2-yl)-3,3-difluoroazetidine.
Analyze 1-(3,3-dimethylbut-1-en-2-yl)-3,3-difluoroazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylbut-1-en-2-yl)-3,3-difluoroazetidine?
The IUPAC name of 1-(3,3-dimethylbut-1-en-2-yl)-3,3-difluoroazetidine (CID 154973616) is 1-(3,3-dimethylbut-1-en-2-yl)-3,3-difluoroazetidine.
What is the SMILES notation for 1-(3,3-dimethylbut-1-en-2-yl)-3,3-difluoroazetidine?
The canonical SMILES for 1-(3,3-dimethylbut-1-en-2-yl)-3,3-difluoroazetidine is C=C(N1CC(F)(F)C1)C(C)(C)C.
What is the InChIKey of 1-(3,3-dimethylbut-1-en-2-yl)-3,3-difluoroazetidine?
The InChIKey is TTYREBGDVAJGEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2N/c1-7(8(2,3)4)12-5-9(10,11)6-12/h1,5-6H2,2-4H3.
What are the key properties of 1-(3,3-dimethylbut-1-en-2-yl)-3,3-difluoroazetidine?
1-(3,3-dimethylbut-1-en-2-yl)-3,3-difluoroazetidine has a molecular weight of 175.22 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylbut-1-en-2-yl)-3,3-difluoroazetidine is sourced from PubChem (CID 154973616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).