C25H46N2O — CID 154973652
[4-[(6R,11S,16S)-1-amino-6,11-dimethyl-5-tetracyclo[8.8.0.02,6.011,16]octadecanyl]butylamino]methanol (PubChem CID 154973652) has the molecular formula C25H46N2O and a molecular weight of 390.66 g/mol. Its IUPAC name is [4-[(6R,11S,16S)-1-amino-6,11-dimethyl-5-tetracyclo[8.8.0.02,6.011,16]octadecanyl]butylamino]methanol.
| Compound Name | [4-[(6R,11S,16S)-1-amino-6,11-dimethyl-5-tetracyclo[8.8.0.02,6.011,16]octadecanyl]butylamino]methanol |
|---|---|
| PubChem CID | 154973652 |
| Molecular Formula | C25H46N2O |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.36 |
| IUPAC Name | [4-[(6R,11S,16S)-1-amino-6,11-dimethyl-5-tetracyclo[8.8.0.02,6.011,16]octadecanyl]butylamino]methanol |
| SMILES | C[C@]12CCCC3C(N)(CC[C@@H]4CCCC[C@]34C)C1CCC2CCCCNCO |
| InChI | InChI=1S/C25H46N2O/c1-23-14-5-3-8-20(23)13-16-25(26)21(23)10-7-15-24(2)19(11-12-22(24)25)9-4-6-17-27-18-28/h19-22,27-28H,3-18,26H2,1-2H3/t19?,20-,21?,22?,23-,24+,25?/m0/s1 |
| InChIKey | GJEABUPKOLBUFY-AESAIBPASA-N |
| XLogP | 5.22 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|