C18H22FN3O2S — CID 154973847
N-[(E)-2-fluoro-2-(2-methyl-6-spiro[1,2,3,3a,4,6a-hexahydropyrrolo[3,4-b]pyrrole-6,1'-cyclopropane]-5-ylsulfonylphenyl)ethenyl]methanimine (PubChem CID 154973847) has the molecular formula C18H22FN3O2S and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[(E)-2-fluoro-2-(2-methyl-6-spiro[1,2,3,3a,4,6a-hexahydropyrrolo[3,4-b]pyrrole-6,1'-cyclopropane]-5-ylsulfonylphenyl)ethenyl]methanimine.
| Compound Name | N-[(E)-2-fluoro-2-(2-methyl-6-spiro[1,2,3,3a,4,6a-hexahydropyrrolo[3,4-b]pyrrole-6,1'-cyclopropane]-5-ylsulfonylphenyl)ethenyl]methanimine |
|---|---|
| PubChem CID | 154973847 |
| Molecular Formula | C18H22FN3O2S |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-[(E)-2-fluoro-2-(2-methyl-6-spiro[1,2,3,3a,4,6a-hexahydropyrrolo[3,4-b]pyrrole-6,1'-cyclopropane]-5-ylsulfonylphenyl)ethenyl]methanimine |
| SMILES | C=N/C=C(/F)c1c(C)cccc1S(=O)(=O)N1CC2CCNC2C12CC2 |
| InChI | InChI=1S/C18H22FN3O2S/c1-12-4-3-5-15(16(12)14(19)10-20-2)25(23,24)22-11-13-6-9-21-17(13)18(22)7-8-18/h3-5,10,13,17,21H,2,6-9,11H2,1H3/b14-10+ |
| InChIKey | NHTKAFFSYVMCMC-GXDHUFHOSA-N |
| XLogP | 2.48 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|