C13H20O2 — CID 154974152
2-methoxy-5-(2-methylpentyl)phenol (PubChem CID 154974152) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-methoxy-5-(2-methylpentyl)phenol.
| Compound Name | 2-methoxy-5-(2-methylpentyl)phenol |
|---|---|
| PubChem CID | 154974152 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-methoxy-5-(2-methylpentyl)phenol |
| SMILES | CCCC(C)Cc1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C13H20O2/c1-4-5-10(2)8-11-6-7-13(15-3)12(14)9-11/h6-7,9-10,14H,4-5,8H2,1-3H3 |
| InChIKey | GBFZRFNRZFDHIV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |