About (2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane
(2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane (PubChem CID 154974176) has the molecular formula C8H11F3
and a molecular weight of 164.17 g/mol. Its IUPAC name is (2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane.
Molecular Properties
| Compound Name | (2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane |
| PubChem CID | 154974176 |
| Molecular Formula | C8H11F3 |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane |
| SMILES | C[C@@H]1C2(C)CC1(C(F)(F)F)C2 |
| InChI | InChI=1S/C8H11F3/c1-5-6(2)3-7(5,4-6)8(9,10)11/h5H,3-4H2,1-2H3/t5-,6?,7?/m1/s1 |
| InChIKey | FHIQOJJGJLEABX-GRQBKTHUSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane?
The IUPAC name of (2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane (CID 154974176) is (2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane.
What is the SMILES notation for (2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane?
The canonical SMILES for (2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane is C[C@@H]1C2(C)CC1(C(F)(F)F)C2.
What is the InChIKey of (2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane?
The InChIKey is FHIQOJJGJLEABX-GRQBKTHUSA-N. The full InChI is InChI=1S/C8H11F3/c1-5-6(2)3-7(5,4-6)8(9,10)11/h5H,3-4H2,1-2H3/t5-,6?,7?/m1/s1.
What are the key properties of (2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane?
(2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane has a molecular weight of 164.17 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,2-dimethyl-3-(trifluoromethyl)bicyclo[1.1.1]pentane is sourced from PubChem (CID 154974176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).