C28H36F2N4O3 — CID 154974325
(1R,4R)-5-[6-[[(1S,4S)-4-ethoxy-3,3-difluorocyclohexyl]methoxymethyl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-8-yl]-2-oxa-5-azabicyclo[2.2.2]octane (PubChem CID 154974325) has the molecular formula C28H36F2N4O3 and a molecular weight of 514.62 g/mol. Its IUPAC name is (1R,4R)-5-[6-[[(1S,4S)-4-ethoxy-3,3-difluorocyclohexyl]methoxymethyl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-8-yl]-2-oxa-5-azabicyclo[2.2.2]octane.
| Compound Name | (1R,4R)-5-[6-[[(1S,4S)-4-ethoxy-3,3-difluorocyclohexyl]methoxymethyl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-8-yl]-2-oxa-5-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 154974325 |
| Molecular Formula | C28H36F2N4O3 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | (1R,4R)-5-[6-[[(1S,4S)-4-ethoxy-3,3-difluorocyclohexyl]methoxymethyl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-8-yl]-2-oxa-5-azabicyclo[2.2.2]octane |
| SMILES | CCO[C@H]1CC[C@H](COCN2Cc3cccnc3Nc3ccc(N4C[C@H]5CC[C@@H]4CO5)cc32)CC1(F)F |
| InChI | InChI=1S/C28H36F2N4O3/c1-2-36-26-10-5-19(13-28(26,29)30)16-35-18-33-14-20-4-3-11-31-27(20)32-24-9-7-21(12-25(24)33)34-15-23-8-6-22(34)17-37-23/h3-4,7,9,11-12,19,22-23,26H,2,5-6,8,10,13-18H2,1H3,(H,31,32)/t19-,22+,23+,26-/m0/s1 |
| InChIKey | PWAYCXWIANRPLQ-YCUIJWHHSA-N |
| XLogP | 5.33 |
| TPSA | 59.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |