C17H16N4O — CID 154974483
2-(6-formyl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-8-yl)-2-methylpropanenitrile (PubChem CID 154974483) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-(6-formyl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-8-yl)-2-methylpropanenitrile.
| Compound Name | 2-(6-formyl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-8-yl)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 154974483 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(6-formyl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-8-yl)-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)c1ccc2c(c1)N(C=O)Cc1cccnc1N2 |
| InChI | InChI=1S/C17H16N4O/c1-17(2,10-18)13-5-6-14-15(8-13)21(11-22)9-12-4-3-7-19-16(12)20-14/h3-8,11H,9H2,1-2H3,(H,19,20) |
| InChIKey | LRCUITQAIOQQTI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|