About 1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine
1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine (PubChem CID 154974617) has the molecular formula C15H31FN2
and a molecular weight of 258.42 g/mol. Its IUPAC name is 1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine.
Molecular Properties
| Compound Name | 1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine |
| PubChem CID | 154974617 |
| Molecular Formula | C15H31FN2 |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.25 |
| IUPAC Name | 1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine |
| SMILES | CCC(CCC(C(C)F)C1CCCC1)N(C)NC |
| InChI | InChI=1S/C15H31FN2/c1-5-14(18(4)17-3)10-11-15(12(2)16)13-8-6-7-9-13/h12-15,17H,5-11H2,1-4H3 |
| InChIKey | CYBKFGRZVVJFRD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine?
The IUPAC name of 1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine (CID 154974617) is 1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine.
What is the SMILES notation for 1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine?
The canonical SMILES for 1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine is CCC(CCC(C(C)F)C1CCCC1)N(C)NC.
What is the InChIKey of 1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine?
The InChIKey is CYBKFGRZVVJFRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31FN2/c1-5-14(18(4)17-3)10-11-15(12(2)16)13-8-6-7-9-13/h12-15,17H,5-11H2,1-4H3.
What are the key properties of 1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine?
1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine has a molecular weight of 258.42 g/mol, XLogP of 3.78, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-cyclopentyl-7-fluorooctan-3-yl)-1,2-dimethylhydrazine is sourced from PubChem (CID 154974617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).