About 5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole
5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole (PubChem CID 154975544) has the molecular formula C20H15FN2O2
and a molecular weight of 334.35 g/mol. Its IUPAC name is 5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole |
| PubChem CID | 154975544 |
| Molecular Formula | C20H15FN2O2 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole |
| SMILES | Cc1ccc(-c2ncc(Cc3ccc(-c4ncco4)c(F)c3)o2)cc1 |
| InChI | InChI=1S/C20H15FN2O2/c1-13-2-5-15(6-3-13)19-23-12-16(25-19)10-14-4-7-17(18(21)11-14)20-22-8-9-24-20/h2-9,11-12H,10H2,1H3 |
| InChIKey | XYKWZLVXUMKZAK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole?
The IUPAC name of 5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole (CID 154975544) is 5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole.
What is the SMILES notation for 5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole?
The canonical SMILES for 5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole is Cc1ccc(-c2ncc(Cc3ccc(-c4ncco4)c(F)c3)o2)cc1.
What is the InChIKey of 5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole?
The InChIKey is XYKWZLVXUMKZAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15FN2O2/c1-13-2-5-15(6-3-13)19-23-12-16(25-19)10-14-4-7-17(18(21)11-14)20-22-8-9-24-20/h2-9,11-12H,10H2,1H3.
What are the key properties of 5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole?
5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole has a molecular weight of 334.35 g/mol, XLogP of 5.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3-fluoro-4-(1,3-oxazol-2-yl)phenyl]methyl]-2-(4-methylphenyl)-1,3-oxazole is sourced from PubChem (CID 154975544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).