C23H30ClN3O2 — CID 154975883
(4aS,10bS)-8-chloro-5,5-dimethyl-1'-[(5-methyl-1H-imidazol-4-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] (PubChem CID 154975883) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is (4aS,10bS)-8-chloro-5,5-dimethyl-1'-[(5-methyl-1H-imidazol-4-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine].
| Compound Name | (4aS,10bS)-8-chloro-5,5-dimethyl-1'-[(5-methyl-1H-imidazol-4-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] |
|---|---|
| PubChem CID | 154975883 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (4aS,10bS)-8-chloro-5,5-dimethyl-1'-[(5-methyl-1H-imidazol-4-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] |
| SMILES | Cc1[nH]cnc1CN1CCC2(CC1)CO[C@@H]1c3ccc(Cl)cc3OC(C)(C)[C@H]1C2 |
| InChI | InChI=1S/C23H30ClN3O2/c1-15-19(26-14-25-15)12-27-8-6-23(7-9-27)11-18-21(28-13-23)17-5-4-16(24)10-20(17)29-22(18,2)3/h4-5,10,14,18,21H,6-9,11-13H2,1-3H3,(H,25,26)/t18-,21+/m0/s1 |
| InChIKey | PSMLAMNCKIJHKF-GHTZIAJQSA-N |
| XLogP | 4.90 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |