C9H17F3N2O2 — CID 154976708
1-methylcyclohexane-1,4-diamine;2,2,2-trifluoroacetic acid (PubChem CID 154976708) has the molecular formula C9H17F3N2O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 1-methylcyclohexane-1,4-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-methylcyclohexane-1,4-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154976708 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-methylcyclohexane-1,4-diamine;2,2,2-trifluoroacetic acid |
| SMILES | CC1(N)CCC(N)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H16N2.C2HF3O2/c1-7(9)4-2-6(8)3-5-7;3-2(4,5)1(6)7/h6H,2-5,8-9H2,1H3;(H,6,7) |
| InChIKey | BYUZADRPVJCRPP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |