About 3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-2-amine
3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-2-amine (PubChem CID 154977050) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-2-amine.
Analyze 3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-2-amine?
The IUPAC name of 3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-2-amine (CID 154977050) is 3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-2-amine.
What is the SMILES notation for 3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-2-amine?
The canonical SMILES for 3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-2-amine is NC1CN2CCCCCC2=N1.
What is the InChIKey of 3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-2-amine?
The InChIKey is IZXCZMZFTGOWQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c9-7-6-11-5-3-1-2-4-8(11)10-7/h7H,1-6,9H2.
What are the key properties of 3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-2-amine?
3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-2-amine has a molecular weight of 153.23 g/mol, XLogP of 0.56, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepin-2-amine is sourced from PubChem (CID 154977050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).