C28H29FN3O4P — CID 154977745
[(11R)-11-[1-fluoro-7-(1-phosphanylethenyl)-6-[(Z)-prop-1-enyl]-8,9-dihydro-5H-benzo[7]annulen-5-yl]-4,8-dioxo-9-propan-2-yl-1,2,9-triazabicyclo[5.4.0]undeca-2,5,6-trien-5-yl] formate (PubChem CID 154977745) has the molecular formula C28H29FN3O4P and a molecular weight of 521.53 g/mol. Its IUPAC name is [(11R)-11-[1-fluoro-7-(1-phosphanylethenyl)-6-[(Z)-prop-1-enyl]-8,9-dihydro-5H-benzo[7]annulen-5-yl]-4,8-dioxo-9-propan-2-yl-1,2,9-triazabicyclo[5.4.0]undeca-2,5,6-trien-5-yl] formate.
| Compound Name | [(11R)-11-[1-fluoro-7-(1-phosphanylethenyl)-6-[(Z)-prop-1-enyl]-8,9-dihydro-5H-benzo[7]annulen-5-yl]-4,8-dioxo-9-propan-2-yl-1,2,9-triazabicyclo[5.4.0]undeca-2,5,6-trien-5-yl] formate |
|---|---|
| PubChem CID | 154977745 |
| Molecular Formula | C28H29FN3O4P |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | [(11R)-11-[1-fluoro-7-(1-phosphanylethenyl)-6-[(Z)-prop-1-enyl]-8,9-dihydro-5H-benzo[7]annulen-5-yl]-4,8-dioxo-9-propan-2-yl-1,2,9-triazabicyclo[5.4.0]undeca-2,5,6-trien-5-yl] formate |
| SMILES | C=C(P)C1=C(/C=C\C)C([C@@H]2CN(C(C)C)C(=O)C3=C=C(OC=O)C(=O)C=NN32)c2cccc(F)c2CC1 |
| InChI | InChI=1S/C28H29FN3O4P/c1-5-7-20-18(17(4)37)10-11-19-21(8-6-9-22(19)29)27(20)24-14-31(16(2)3)28(35)23-12-26(36-15-33)25(34)13-30-32(23)24/h5-9,13,15-16,24,27H,4,10-11,14,37H2,1-3H3/b7-5-/t24-,27?/m0/s1 |
| InChIKey | PIFSGGQBFZWKEG-ONNOQHGYSA-N |
| XLogP | 4.15 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|