C15H18O2S — CID 15497851
(1S,4R,7R)-4-(benzenesulfinyl)-1-methyl-2-methylidene-8-oxabicyclo[5.1.0]octane (PubChem CID 15497851) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is (1S,4R,7R)-4-(benzenesulfinyl)-1-methyl-2-methylidene-8-oxabicyclo[5.1.0]octane.
| Compound Name | (1S,4R,7R)-4-(benzenesulfinyl)-1-methyl-2-methylidene-8-oxabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 15497851 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (1S,4R,7R)-4-(benzenesulfinyl)-1-methyl-2-methylidene-8-oxabicyclo[5.1.0]octane |
| SMILES | C=C1C[C@H](S(=O)c2ccccc2)CC[C@H]2O[C@@]12C |
| InChI | InChI=1S/C15H18O2S/c1-11-10-13(8-9-14-15(11,2)17-14)18(16)12-6-4-3-5-7-12/h3-7,13-14H,1,8-10H2,2H3/t13-,14-,15+,18?/m1/s1 |
| InChIKey | BTLQNICVBXETIV-HPPSQRKUSA-N |
| XLogP | 3.06 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|