About 5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine
5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine (PubChem CID 154978848) has the molecular formula C14H10N4
and a molecular weight of 234.26 g/mol. Its IUPAC name is 5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine |
| PubChem CID | 154978848 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine |
| SMILES | c1cnn2cc(-c3ccc4[nH]ccc4n3)cc2c1 |
| InChI | InChI=1S/C14H10N4/c1-2-11-8-10(9-18(11)16-6-1)12-3-4-13-14(17-12)5-7-15-13/h1-9,15H |
| InChIKey | BDINDKJVTKFURV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine (CID 154978848) is 5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine is c1cnn2cc(-c3ccc4[nH]ccc4n3)cc2c1.
What is the InChIKey of 5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine?
The InChIKey is BDINDKJVTKFURV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4/c1-2-11-8-10(9-18(11)16-6-1)12-3-4-13-14(17-12)5-7-15-13/h1-9,15H.
What are the key properties of 5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine?
5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine has a molecular weight of 234.26 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrrolo[1,2-b]pyridazin-6-yl-1H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 154978848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).