C21H35NO2 — CID 154978899
6-hydroxy-6-methyl-N-(7-phenylheptyl)heptanamide (PubChem CID 154978899) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is 6-hydroxy-6-methyl-N-(7-phenylheptyl)heptanamide.
| Compound Name | 6-hydroxy-6-methyl-N-(7-phenylheptyl)heptanamide |
|---|---|
| PubChem CID | 154978899 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 6-hydroxy-6-methyl-N-(7-phenylheptyl)heptanamide |
| SMILES | CC(C)(O)CCCCC(=O)NCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C21H35NO2/c1-21(2,24)17-11-10-16-20(23)22-18-12-5-3-4-7-13-19-14-8-6-9-15-19/h6,8-9,14-15,24H,3-5,7,10-13,16-18H2,1-2H3,(H,22,23) |
| InChIKey | CEYYTKMTCUUVFF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|