About Amiloxate
Amiloxate (PubChem CID 1549789) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 3-methylbutyl (E)-3-(4-methoxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | Amiloxate |
| PubChem CID | 1549789 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3-methylbutyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | CC(C)CCOC(=O)/C=C/C1=CC=C(C=C1)OC |
| InChI | InChI=1S/C15H20O3/c1-12(2)10-11-18-15(16)9-6-13-4-7-14(17-3)8-5-13/h4-9,12H,10-11H2,1-3H3/b9-6+ |
| InChIKey | UBNYRXMKIIGMKK-RMKNXTFCSA-N |
| XLogP | 3.90 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | 263 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze Amiloxate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Amiloxate?
The IUPAC name of Amiloxate (CID 1549789) is 3-methylbutyl (E)-3-(4-methoxyphenyl)prop-2-enoate.
What is the SMILES notation for Amiloxate?
The canonical SMILES for Amiloxate is CC(C)CCOC(=O)/C=C/C1=CC=C(C=C1)OC.
What is the InChIKey of Amiloxate?
The InChIKey is UBNYRXMKIIGMKK-RMKNXTFCSA-N. The full InChI is InChI=1S/C15H20O3/c1-12(2)10-11-18-15(16)9-6-13-4-7-14(17-3)8-5-13/h4-9,12H,10-11H2,1-3H3/b9-6+.
What are the key properties of Amiloxate?
Amiloxate has a molecular weight of 248.32 g/mol, XLogP of 3.90, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Amiloxate is sourced from PubChem (CID 1549789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).