C22H34N2 — CID 154979160
(1E,3E,5E)-6-[[(5E,7Z)-5-ethyl-2-methylidenedeca-5,7-dienylidene]amino]-N,4,5-trimethylhexa-1,3,5-trien-1-amine (PubChem CID 154979160) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is (1E,3E,5E)-6-[[(5E,7Z)-5-ethyl-2-methylidenedeca-5,7-dienylidene]amino]-N,4,5-trimethylhexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3E,5E)-6-[[(5E,7Z)-5-ethyl-2-methylidenedeca-5,7-dienylidene]amino]-N,4,5-trimethylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 154979160 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | (1E,3E,5E)-6-[[(5E,7Z)-5-ethyl-2-methylidenedeca-5,7-dienylidene]amino]-N,4,5-trimethylhexa-1,3,5-trien-1-amine |
| SMILES | C=C(/C=N/C=C(C)/C(C)=C/C=C/NC)CC/C(=C/C=C\CC)CC |
| InChI | InChI=1S/C22H34N2/c1-7-9-10-13-22(8-2)15-14-19(3)17-24-18-21(5)20(4)12-11-16-23-6/h9-13,16-18,23H,3,7-8,14-15H2,1-2,4-6H3/b10-9-,16-11+,20-12+,21-18+,22-13+,24-17+ |
| InChIKey | LBUANEBYNKEWLJ-ZAVRZKCKSA-N |
| XLogP | 6.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|