C16H24N2 — CID 154979175
(2S)-N-[3-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]iminoprop-1-en-2-yl]-3-methylidenepent-4-en-2-amine (PubChem CID 154979175) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (2S)-N-[3-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]iminoprop-1-en-2-yl]-3-methylidenepent-4-en-2-amine.
| Compound Name | (2S)-N-[3-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]iminoprop-1-en-2-yl]-3-methylidenepent-4-en-2-amine |
|---|---|
| PubChem CID | 154979175 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (2S)-N-[3-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]iminoprop-1-en-2-yl]-3-methylidenepent-4-en-2-amine |
| SMILES | C=CC(=C)[C@H](C)NC(=C)/C=N/C=C(C)/C(C)=C/C |
| InChI | InChI=1S/C16H24N2/c1-8-12(3)14(5)10-17-11-15(6)18-16(7)13(4)9-2/h8-11,16,18H,2,4,6H2,1,3,5,7H3/b12-8+,14-10+,17-11+/t16-/m0/s1 |
| InChIKey | YDEUIECLFQEAQO-AMKHQMLDSA-N |
| XLogP | 4.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|