C16H19NO2 — CID 15497976
(4aS,6R,8aR)-3-benzyl-6-methyl-4a,5,6,8a-tetrahydro-1H-2,3-benzoxazin-4-one (PubChem CID 15497976) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (4aS,6R,8aR)-3-benzyl-6-methyl-4a,5,6,8a-tetrahydro-1H-2,3-benzoxazin-4-one.
| Compound Name | (4aS,6R,8aR)-3-benzyl-6-methyl-4a,5,6,8a-tetrahydro-1H-2,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 15497976 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (4aS,6R,8aR)-3-benzyl-6-methyl-4a,5,6,8a-tetrahydro-1H-2,3-benzoxazin-4-one |
| SMILES | C[C@H]1C=C[C@H]2CON(Cc3ccccc3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C16H19NO2/c1-12-7-8-14-11-19-17(16(18)15(14)9-12)10-13-5-3-2-4-6-13/h2-8,12,14-15H,9-11H2,1H3/t12-,14-,15-/m0/s1 |
| InChIKey | WVEULFHABICFGX-QEJZJMRPSA-N |
| XLogP | 2.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|