C32H26N4 — CID 154979781
N-phenyl-4-[(E)-[(E)-[4-(N-phenylanilino)phenyl]methylidenehydrazinylidene]methyl]aniline (PubChem CID 154979781) has the molecular formula C32H26N4 and a molecular weight of 466.59 g/mol. Its IUPAC name is N-phenyl-4-[(E)-[(E)-[4-(N-phenylanilino)phenyl]methylidenehydrazinylidene]methyl]aniline.
| Compound Name | N-phenyl-4-[(E)-[(E)-[4-(N-phenylanilino)phenyl]methylidenehydrazinylidene]methyl]aniline |
|---|---|
| PubChem CID | 154979781 |
| Molecular Formula | C32H26N4 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-phenyl-4-[(E)-[(E)-[4-(N-phenylanilino)phenyl]methylidenehydrazinylidene]methyl]aniline |
| SMILES | C(=N/N=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1)\c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C32H26N4/c1-4-10-28(11-5-1)35-29-20-16-26(17-21-29)24-33-34-25-27-18-22-32(23-19-27)36(30-12-6-2-7-13-30)31-14-8-3-9-15-31/h1-25,35H/b33-24+,34-25+ |
| InChIKey | JXNPASXPQZMHBQ-WASGUHIUSA-N |
| XLogP | 8.35 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|