C17H21NO3 — CID 15497989
(1S,4aS,8aR)-3-benzyl-1,4a-dimethyl-5,6,8,8a-tetrahydro-1H-benzo[d]oxazine-4,7-dione (PubChem CID 15497989) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (1S,4aS,8aR)-3-benzyl-1,4a-dimethyl-5,6,8,8a-tetrahydro-1H-benzo[d]oxazine-4,7-dione.
| Compound Name | (1S,4aS,8aR)-3-benzyl-1,4a-dimethyl-5,6,8,8a-tetrahydro-1H-benzo[d]oxazine-4,7-dione |
|---|---|
| PubChem CID | 15497989 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (1S,4aS,8aR)-3-benzyl-1,4a-dimethyl-5,6,8,8a-tetrahydro-1H-benzo[d]oxazine-4,7-dione |
| SMILES | C[C@@H]1ON(Cc2ccccc2)C(=O)[C@@]2(C)CCC(=O)C[C@@H]12 |
| InChI | InChI=1S/C17H21NO3/c1-12-15-10-14(19)8-9-17(15,2)16(20)18(21-12)11-13-6-4-3-5-7-13/h3-7,12,15H,8-11H2,1-2H3/t12-,15-,17-/m0/s1 |
| InChIKey | VVHVDWIXZTZYNW-NUTKFTJISA-N |
| XLogP | 2.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |