C23H37N — CID 154979941
4,4,5,5,8-pentamethyl-6-phenyl-2-propan-2-ylnonanenitrile (PubChem CID 154979941) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is 4,4,5,5,8-pentamethyl-6-phenyl-2-propan-2-ylnonanenitrile.
| Compound Name | 4,4,5,5,8-pentamethyl-6-phenyl-2-propan-2-ylnonanenitrile |
|---|---|
| PubChem CID | 154979941 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | 4,4,5,5,8-pentamethyl-6-phenyl-2-propan-2-ylnonanenitrile |
| SMILES | CC(C)CC(c1ccccc1)C(C)(C)C(C)(C)CC(C#N)C(C)C |
| InChI | InChI=1S/C23H37N/c1-17(2)14-21(19-12-10-9-11-13-19)23(7,8)22(5,6)15-20(16-24)18(3)4/h9-13,17-18,20-21H,14-15H2,1-8H3 |
| InChIKey | YHHJQEHAGDEPDQ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |