C17H26F3NO2 — CID 154980138
(E)-7-[ethyl-[(E)-5-methyl-4-oxohex-2-enyl]amino]-1,1,1-trifluoro-5-methylhept-2-en-4-one (PubChem CID 154980138) has the molecular formula C17H26F3NO2 and a molecular weight of 333.39 g/mol. Its IUPAC name is (E)-7-[ethyl-[(E)-5-methyl-4-oxohex-2-enyl]amino]-1,1,1-trifluoro-5-methylhept-2-en-4-one.
| Compound Name | (E)-7-[ethyl-[(E)-5-methyl-4-oxohex-2-enyl]amino]-1,1,1-trifluoro-5-methylhept-2-en-4-one |
|---|---|
| PubChem CID | 154980138 |
| Molecular Formula | C17H26F3NO2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (E)-7-[ethyl-[(E)-5-methyl-4-oxohex-2-enyl]amino]-1,1,1-trifluoro-5-methylhept-2-en-4-one |
| SMILES | CCN(C/C=C/C(=O)C(C)C)CCC(C)C(=O)/C=C/C(F)(F)F |
| InChI | InChI=1S/C17H26F3NO2/c1-5-21(11-6-7-15(22)13(2)3)12-9-14(4)16(23)8-10-17(18,19)20/h6-8,10,13-14H,5,9,11-12H2,1-4H3/b7-6+,10-8+ |
| InChIKey | RWJSKUVSHIMSSG-LQPGMRSMSA-N |
| XLogP | 3.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|