C19H31NO2 — CID 154980310
methyl (2E,4E)-2-butan-2-yl-4-[[(3R)-3-methylpiperidin-1-yl]methyl]hepta-2,4,6-trienoate (PubChem CID 154980310) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is methyl (2E,4E)-2-butan-2-yl-4-[[(3R)-3-methylpiperidin-1-yl]methyl]hepta-2,4,6-trienoate.
| Compound Name | methyl (2E,4E)-2-butan-2-yl-4-[[(3R)-3-methylpiperidin-1-yl]methyl]hepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 154980310 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | methyl (2E,4E)-2-butan-2-yl-4-[[(3R)-3-methylpiperidin-1-yl]methyl]hepta-2,4,6-trienoate |
| SMILES | C=C/C=C(\C=C(\C(=O)OC)C(C)CC)CN1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C19H31NO2/c1-6-9-17(14-20-11-8-10-15(3)13-20)12-18(16(4)7-2)19(21)22-5/h6,9,12,15-16H,1,7-8,10-11,13-14H2,2-5H3/b17-9+,18-12+/t15-,16?/m1/s1 |
| InChIKey | WPAGZHAFDAVAQD-YUHTUVEKSA-N |
| XLogP | 3.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|