About 4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine
4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine (PubChem CID 154980352) has the molecular formula C10H10ClIN2
and a molecular weight of 320.56 g/mol. Its IUPAC name is 4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine.
Molecular Properties
| Compound Name | 4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine |
| PubChem CID | 154980352 |
| Molecular Formula | C10H10ClIN2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine |
| SMILES | CCC1=CN=c2[nH]c(I)cc2=C(Cl)C1 |
| InChI | InChI=1S/C10H10ClIN2/c1-2-6-3-8(11)7-4-9(12)14-10(7)13-5-6/h4-5H,2-3H2,1H3,(H,13,14) |
| InChIKey | OHNWEUJTGNNTHM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine?
The IUPAC name of 4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine (CID 154980352) is 4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine.
What is the SMILES notation for 4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine?
The canonical SMILES for 4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine is CCC1=CN=c2[nH]c(I)cc2=C(Cl)C1.
What is the InChIKey of 4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine?
The InChIKey is OHNWEUJTGNNTHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClIN2/c1-2-6-3-8(11)7-4-9(12)14-10(7)13-5-6/h4-5H,2-3H2,1H3,(H,13,14).
What are the key properties of 4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine?
4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine has a molecular weight of 320.56 g/mol, XLogP of 2.28, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-ethyl-2-iodo-1,5-dihydropyrrolo[2,3-b]azepine is sourced from PubChem (CID 154980352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).