C26H47N3 — CID 154980407
N'-ethyl-N-[4-[ethyl-[(6Z)-4-propan-2-ylidene-5-propylnona-1,6,8-trien-2-yl]amino]butan-2-yl]-N-methylethanimidamide (PubChem CID 154980407) has the molecular formula C26H47N3 and a molecular weight of 401.68 g/mol. Its IUPAC name is N'-ethyl-N-[4-[ethyl-[(6Z)-4-propan-2-ylidene-5-propylnona-1,6,8-trien-2-yl]amino]butan-2-yl]-N-methylethanimidamide.
| Compound Name | N'-ethyl-N-[4-[ethyl-[(6Z)-4-propan-2-ylidene-5-propylnona-1,6,8-trien-2-yl]amino]butan-2-yl]-N-methylethanimidamide |
|---|---|
| PubChem CID | 154980407 |
| Molecular Formula | C26H47N3 |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.38 |
| IUPAC Name | N'-ethyl-N-[4-[ethyl-[(6Z)-4-propan-2-ylidene-5-propylnona-1,6,8-trien-2-yl]amino]butan-2-yl]-N-methylethanimidamide |
| SMILES | C=C/C=C\C(CCC)C(CC(=C)N(CC)CCC(C)N(C)/C(C)=N/CC)=C(C)C |
| InChI | InChI=1S/C26H47N3/c1-11-15-17-25(16-12-2)26(21(5)6)20-23(8)29(14-4)19-18-22(7)28(10)24(9)27-13-3/h11,15,17,22,25H,1,8,12-14,16,18-20H2,2-7,9-10H3/b17-15-,27-24+ |
| InChIKey | UMFBRKBOCOZDTM-SXNRGMJRSA-N |
| XLogP | 6.86 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|