C14H14FN3O5 — CID 154980443
3-[5-fluoro-1,1-dihydroxy-7-(methylamino)-3-oxoisoindol-2-yl]piperidine-2,6-dione (PubChem CID 154980443) has the molecular formula C14H14FN3O5 and a molecular weight of 323.28 g/mol. Its IUPAC name is 3-[5-fluoro-1,1-dihydroxy-7-(methylamino)-3-oxoisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-1,1-dihydroxy-7-(methylamino)-3-oxoisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154980443 |
| Molecular Formula | C14H14FN3O5 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-[5-fluoro-1,1-dihydroxy-7-(methylamino)-3-oxoisoindol-2-yl]piperidine-2,6-dione |
| SMILES | CNc1cc(F)cc2c1C(O)(O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C14H14FN3O5/c1-16-8-5-6(15)4-7-11(8)14(22,23)18(13(7)21)9-2-3-10(19)17-12(9)20/h4-5,9,16,22-23H,2-3H2,1H3,(H,17,19,20) |
| InChIKey | VKANTSVXPSRWMD-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|