About 4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene
4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene (PubChem CID 15498114) has the molecular formula C10H11N
and a molecular weight of 145.21 g/mol. Its IUPAC name is 4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene.
Molecular Properties
| Compound Name | 4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene |
| PubChem CID | 15498114 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene |
| SMILES | c1cc2c3c(c1)CCN3CC2 |
| InChI | InChI=1S/C10H11N/c1-2-8-4-6-11-7-5-9(3-1)10(8)11/h1-3H,4-7H2 |
| InChIKey | NNPDYSRXPOFUPW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene?
The IUPAC name of 4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene (CID 15498114) is 4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene.
What is the SMILES notation for 4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene?
The canonical SMILES for 4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene is c1cc2c3c(c1)CCN3CC2.
What is the InChIKey of 4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene?
The InChIKey is NNPDYSRXPOFUPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-2-8-4-6-11-7-5-9(3-1)10(8)11/h1-3H,4-7H2.
What are the key properties of 4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene?
4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene has a molecular weight of 145.21 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatricyclo[5.3.1.04,11]undeca-1(11),7,9-triene is sourced from PubChem (CID 15498114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).