C14H23N2+ — CID 154981386
(2Z,5E)-5-ethenyl-2,4,7-trimethylnona-2,5-diene-1-diazonium (PubChem CID 154981386) has the molecular formula C14H23N2+ and a molecular weight of 219.35 g/mol. Its IUPAC name is (2Z,5E)-5-ethenyl-2,4,7-trimethylnona-2,5-diene-1-diazonium.
| Compound Name | (2Z,5E)-5-ethenyl-2,4,7-trimethylnona-2,5-diene-1-diazonium |
|---|---|
| PubChem CID | 154981386 |
| Molecular Formula | C14H23N2+ |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.19 |
| IUPAC Name | (2Z,5E)-5-ethenyl-2,4,7-trimethylnona-2,5-diene-1-diazonium |
| SMILES | C=C/C(=C\C(C)CC)C(C)/C=C(/C)C[N+]#N |
| InChI | InChI=1S/C14H23N2/c1-6-11(3)9-14(7-2)13(5)8-12(4)10-16-15/h7-9,11,13H,2,6,10H2,1,3-5H3/q+1/b12-8-,14-9+ |
| InChIKey | JRKRKFSLOXZYPJ-WNEGCBGQSA-N |
| XLogP | 4.58 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|