C18H32N2O — CID 154981427
(2R)-1-methyl-N-[1-[(2S,5R)-1,2,3,4,5-pentamethylcyclopentyl]ethenyl]pyrrolidine-2-carboxamide (PubChem CID 154981427) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is (2R)-1-methyl-N-[1-[(2S,5R)-1,2,3,4,5-pentamethylcyclopentyl]ethenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-methyl-N-[1-[(2S,5R)-1,2,3,4,5-pentamethylcyclopentyl]ethenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154981427 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | (2R)-1-methyl-N-[1-[(2S,5R)-1,2,3,4,5-pentamethylcyclopentyl]ethenyl]pyrrolidine-2-carboxamide |
| SMILES | C=C(NC(=O)[C@H]1CCCN1C)C1(C)[C@H](C)C(C)C(C)[C@@H]1C |
| InChI | InChI=1S/C18H32N2O/c1-11-12(2)14(4)18(6,13(11)3)15(5)19-17(21)16-9-8-10-20(16)7/h11-14,16H,5,8-10H2,1-4,6-7H3,(H,19,21)/t11?,12?,13-,14+,16-,18?/m1/s1 |
| InChIKey | MEGSFUHMPGEYNH-LSELAVJVSA-N |
| XLogP | 3.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |