C26H36N2O2 — CID 154981677
N-[[4-(piperidine-1-carbonyl)phenyl]methyl]-1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylene-5-carboxamide (PubChem CID 154981677) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is N-[[4-(piperidine-1-carbonyl)phenyl]methyl]-1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylene-5-carboxamide.
| Compound Name | N-[[4-(piperidine-1-carbonyl)phenyl]methyl]-1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylene-5-carboxamide |
|---|---|
| PubChem CID | 154981677 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | N-[[4-(piperidine-1-carbonyl)phenyl]methyl]-1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylene-5-carboxamide |
| SMILES | O=C(NCc1ccc(C(=O)N2CCCCC2)cc1)C1CCC2CCC3CCCC1C32 |
| InChI | InChI=1S/C26H36N2O2/c29-25(23-14-13-20-12-11-19-5-4-6-22(23)24(19)20)27-17-18-7-9-21(10-8-18)26(30)28-15-2-1-3-16-28/h7-10,19-20,22-24H,1-6,11-17H2,(H,27,29) |
| InChIKey | VPFPVZHVFBVTRJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |