About (2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine
(2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine (PubChem CID 154981691) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is (2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine.
Molecular Properties
| Compound Name | (2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine |
| PubChem CID | 154981691 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine |
| SMILES | C=C(CC/C=C(\C)CN)OCCOC |
| InChI | InChI=1S/C11H21NO2/c1-10(9-12)5-4-6-11(2)14-8-7-13-3/h5H,2,4,6-9,12H2,1,3H3/b10-5+ |
| InChIKey | DAJSREWPUNLRIP-BJMVGYQFSA-N |
| XLogP | 1.85 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine?
The IUPAC name of (2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine (CID 154981691) is (2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine.
What is the SMILES notation for (2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine?
The canonical SMILES for (2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine is C=C(CC/C=C(\C)CN)OCCOC.
What is the InChIKey of (2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine?
The InChIKey is DAJSREWPUNLRIP-BJMVGYQFSA-N. The full InChI is InChI=1S/C11H21NO2/c1-10(9-12)5-4-6-11(2)14-8-7-13-3/h5H,2,4,6-9,12H2,1,3H3/b10-5+.
What are the key properties of (2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine?
(2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine has a molecular weight of 199.29 g/mol, XLogP of 1.85, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-6-(2-methoxyethoxy)-2-methylhepta-2,6-dien-1-amine is sourced from PubChem (CID 154981691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).