C13H20FN3 — CID 154981699
2-[(2E,3Z)-2-ethylidene-5-fluorohexa-3,5-dienyl]-1-(2-methylprop-1-enyl)guanidine (PubChem CID 154981699) has the molecular formula C13H20FN3 and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-[(2E,3Z)-2-ethylidene-5-fluorohexa-3,5-dienyl]-1-(2-methylprop-1-enyl)guanidine.
| Compound Name | 2-[(2E,3Z)-2-ethylidene-5-fluorohexa-3,5-dienyl]-1-(2-methylprop-1-enyl)guanidine |
|---|---|
| PubChem CID | 154981699 |
| Molecular Formula | C13H20FN3 |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-[(2E,3Z)-2-ethylidene-5-fluorohexa-3,5-dienyl]-1-(2-methylprop-1-enyl)guanidine |
| SMILES | C=C(F)/C=C\C(=C/C)C/N=C(\N)NC=C(C)C |
| InChI | InChI=1S/C13H20FN3/c1-5-12(7-6-11(4)14)9-17-13(15)16-8-10(2)3/h5-8H,4,9H2,1-3H3,(H3,15,16,17)/b7-6-,12-5+ |
| InChIKey | XXTFMVDNTZDSSA-BZNMCICSSA-N |
| XLogP | 2.80 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|