C17H13FN4O3 — CID 154981756
6-fluoro-13-methyl-2,10-dioxa-13,17,19,21-tetrazapentacyclo[13.5.2.03,12.04,9.018,22]docosa-1(20),4(9),5,7,15,18,21-heptaen-14-one (PubChem CID 154981756) has the molecular formula C17H13FN4O3 and a molecular weight of 340.31 g/mol. Its IUPAC name is 6-fluoro-13-methyl-2,10-dioxa-13,17,19,21-tetrazapentacyclo[13.5.2.03,12.04,9.018,22]docosa-1(20),4(9),5,7,15,18,21-heptaen-14-one.
| Compound Name | 6-fluoro-13-methyl-2,10-dioxa-13,17,19,21-tetrazapentacyclo[13.5.2.03,12.04,9.018,22]docosa-1(20),4(9),5,7,15,18,21-heptaen-14-one |
|---|---|
| PubChem CID | 154981756 |
| Molecular Formula | C17H13FN4O3 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 6-fluoro-13-methyl-2,10-dioxa-13,17,19,21-tetrazapentacyclo[13.5.2.03,12.04,9.018,22]docosa-1(20),4(9),5,7,15,18,21-heptaen-14-one |
| SMILES | CN1C(=O)c2c[nH]c3ncc(nc23)OC2c3cc(F)ccc3OCC21 |
| InChI | InChI=1S/C17H13FN4O3/c1-22-11-7-24-12-3-2-8(18)4-9(12)15(11)25-13-6-20-16-14(21-13)10(5-19-16)17(22)23/h2-6,11,15H,7H2,1H3,(H,19,20) |
| InChIKey | MUJIXYAJTVQWGS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |